C14H19NO2 — CID 87583926
6-[3-(2-aminoethoxy)phenyl]hex-1-yn-3-ol (PubChem CID 87583926) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 6-[3-(2-aminoethoxy)phenyl]hex-1-yn-3-ol.
| Compound Name | 6-[3-(2-aminoethoxy)phenyl]hex-1-yn-3-ol |
|---|---|
| PubChem CID | 87583926 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 6-[3-(2-aminoethoxy)phenyl]hex-1-yn-3-ol |
| SMILES | C#CC(O)CCCc1cccc(OCCN)c1 |
| InChI | InChI=1S/C14H19NO2/c1-2-13(16)7-3-5-12-6-4-8-14(11-12)17-10-9-15/h1,4,6,8,11,13,16H,3,5,7,9-10,15H2 |
| InChIKey | ZKKZRUQUVSHFLG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|