C25H43NO12S — CID 137448931
S-[[3-[2-[[(2S,3S,4R,6S)-2,3,4,6,7-pentahydroxyheptyl]-[(2S,3S,5S,6R)-2,3,5,6,7-pentahydroxyheptyl]amino]ethoxy]phenyl]methyl] ethanethioate (PubChem CID 137448931) has the molecular formula C25H43NO12S and a molecular weight of 581.68 g/mol. Its IUPAC name is S-[[3-[2-[[(2S,3S,4R,6S)-2,3,4,6,7-pentahydroxyheptyl]-[(2S,3S,5S,6R)-2,3,5,6,7-pentahydroxyheptyl]amino]ethoxy]phenyl]methyl] ethanethioate.
| Compound Name | S-[[3-[2-[[(2S,3S,4R,6S)-2,3,4,6,7-pentahydroxyheptyl]-[(2S,3S,5S,6R)-2,3,5,6,7-pentahydroxyheptyl]amino]ethoxy]phenyl]methyl] ethanethioate |
|---|---|
| PubChem CID | 137448931 |
| Molecular Formula | C25H43NO12S |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | S-[[3-[2-[[(2S,3S,4R,6S)-2,3,4,6,7-pentahydroxyheptyl]-[(2S,3S,5S,6R)-2,3,5,6,7-pentahydroxyheptyl]amino]ethoxy]phenyl]methyl] ethanethioate |
| SMILES | CC(=O)SCc1cccc(OCCN(C[C@H](O)[C@@H](O)[C@H](O)C[C@H](O)CO)C[C@H](O)[C@@H](O)C[C@H](O)[C@H](O)CO)c1 |
| InChI | InChI=1S/C25H43NO12S/c1-15(29)39-14-16-3-2-4-18(7-16)38-6-5-26(10-22(34)19(31)9-20(32)24(36)13-28)11-23(35)25(37)21(33)8-17(30)12-27/h2-4,7,17,19-25,27-28,30-37H,5-6,8-14H2,1H3/t17-,19-,20-,21+,22-,23-,24+,25-/m0/s1 |
| InChIKey | JCEURTHCMXMNRA-JXMKWOBBSA-N |
| XLogP | -3.20 |
| TPSA | 231.84 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|