C17H27NO7S — CID 122463154
S-[[4-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl] ethanethioate (PubChem CID 122463154) has the molecular formula C17H27NO7S and a molecular weight of 389.47 g/mol. Its IUPAC name is S-[[4-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl] ethanethioate.
| Compound Name | S-[[4-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl] ethanethioate |
|---|---|
| PubChem CID | 122463154 |
| Molecular Formula | C17H27NO7S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | S-[[4-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl] ethanethioate |
| SMILES | CC(=O)SCc1ccc(OCCNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C17H27NO7S/c1-11(20)26-10-12-2-4-13(5-3-12)25-7-6-18-8-14(21)16(23)17(24)15(22)9-19/h2-5,14-19,21-24H,6-10H2,1H3/t14-,15+,16+,17+/m0/s1 |
| InChIKey | JXPCLKRZTSOCQU-YLFCFFPRSA-N |
| XLogP | -1.13 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|