C26H42N3O7W- — CID 164773750
1-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]-2-[4-(3-piperidin-1-id-4-ylpropoxy)phenyl]ethanone;tungsten (PubChem CID 164773750) has the molecular formula C26H42N3O7W- and a molecular weight of 692.48 g/mol. Its IUPAC name is 1-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]-2-[4-(3-piperidin-1-id-4-ylpropoxy)phenyl]ethanone;tungsten.
| Compound Name | 1-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]-2-[4-(3-piperidin-1-id-4-ylpropoxy)phenyl]ethanone;tungsten |
|---|---|
| PubChem CID | 164773750 |
| Molecular Formula | C26H42N3O7W- |
| Molecular Weight | 692.48 g/mol |
| Exact Mass | 692.25 |
| IUPAC Name | 1-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]-2-[4-(3-piperidin-1-id-4-ylpropoxy)phenyl]ethanone;tungsten |
| SMILES | O=C(Cc1ccc(OCCCC2CC[N-]CC2)cc1)N1CC(CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C1.[W] |
| InChI | InChI=1S/C26H42N3O7.W/c30-17-23(32)26(35)25(34)22(31)14-28-13-20-15-29(16-20)24(33)12-19-3-5-21(6-4-19)36-11-1-2-18-7-9-27-10-8-18;/h3-6,18,20,22-23,25-26,28,30-32,34-35H,1-2,7-17H2;/q-1;/t22-,23+,25+,26+;/m0./s1 |
| InChIKey | WBZBCGCOVQCSGS-DUSMGPJASA-N |
| XLogP | -0.35 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.48 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|