C31H51F4N3O10 — CID 164773797
[3-(trifluoromethyl)oxetan-3-yl] 4-[3-[3-fluoro-4-[2-oxo-2-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethyl]cyclohexyl]oxypropyl]piperidine-1-carboxylate (PubChem CID 164773797) has the molecular formula C31H51F4N3O10 and a molecular weight of 701.75 g/mol. Its IUPAC name is [3-(trifluoromethyl)oxetan-3-yl] 4-[3-[3-fluoro-4-[2-oxo-2-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethyl]cyclohexyl]oxypropyl]piperidine-1-carboxylate.
| Compound Name | [3-(trifluoromethyl)oxetan-3-yl] 4-[3-[3-fluoro-4-[2-oxo-2-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethyl]cyclohexyl]oxypropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164773797 |
| Molecular Formula | C31H51F4N3O10 |
| Molecular Weight | 701.75 g/mol |
| Exact Mass | 701.35 |
| IUPAC Name | [3-(trifluoromethyl)oxetan-3-yl] 4-[3-[3-fluoro-4-[2-oxo-2-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethyl]cyclohexyl]oxypropyl]piperidine-1-carboxylate |
| SMILES | O=C(CC1CCC(OCCCC2CCN(C(=O)OC3(C(F)(F)F)COC3)CC2)CC1F)N1CC(CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C1 |
| InChI | InChI=1S/C31H51F4N3O10/c32-23-11-22(47-9-1-2-19-5-7-37(8-6-19)29(45)48-30(17-46-18-30)31(33,34)35)4-3-21(23)10-26(42)38-14-20(15-38)12-36-13-24(40)27(43)28(44)25(41)16-39/h19-25,27-28,36,39-41,43-44H,1-18H2/t21?,22?,23?,24-,25+,27+,28+/m0/s1 |
| InChIKey | RICNWNJWUOWUIQ-APJBARPNSA-N |
| XLogP | 0.34 |
| TPSA | 181.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.75 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|