C31H55ClFN5O7 — CID 171744441
2-[4-[3-[1-(5-chloro-1,3-diazinan-2-yl)piperidin-4-yl]propoxy]-2-fluorocyclohexyl]-1-[6-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-2,6-diazaspiro[3.3]heptan-2-yl]ethanone (PubChem CID 171744441) has the molecular formula C31H55ClFN5O7 and a molecular weight of 664.26 g/mol. Its IUPAC name is 2-[4-[3-[1-(5-chloro-1,3-diazinan-2-yl)piperidin-4-yl]propoxy]-2-fluorocyclohexyl]-1-[6-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-2,6-diazaspiro[3.3]heptan-2-yl]ethanone.
| Compound Name | 2-[4-[3-[1-(5-chloro-1,3-diazinan-2-yl)piperidin-4-yl]propoxy]-2-fluorocyclohexyl]-1-[6-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-2,6-diazaspiro[3.3]heptan-2-yl]ethanone |
|---|---|
| PubChem CID | 171744441 |
| Molecular Formula | C31H55ClFN5O7 |
| Molecular Weight | 664.26 g/mol |
| Exact Mass | 663.38 |
| IUPAC Name | 2-[4-[3-[1-(5-chloro-1,3-diazinan-2-yl)piperidin-4-yl]propoxy]-2-fluorocyclohexyl]-1-[6-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-2,6-diazaspiro[3.3]heptan-2-yl]ethanone |
| SMILES | O=C(CC1CCC(OCCCC2CCN(C3NCC(Cl)CN3)CC2)CC1F)N1CC2(CN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C2)C1 |
| InChI | InChI=1S/C31H55ClFN5O7/c32-22-12-34-30(35-13-22)37-7-5-20(6-8-37)2-1-9-45-23-4-3-21(24(33)11-23)10-27(42)38-18-31(19-38)16-36(17-31)14-25(40)28(43)29(44)26(41)15-39/h20-26,28-30,34-35,39-41,43-44H,1-19H2/t21?,22?,23?,24?,25-,26+,28+,29+,30?/m0/s1 |
| InChIKey | PTDHQGQOBJQILM-ASIFTOSGSA-N |
| XLogP | -0.94 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.26 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|