C31H55ClFN5O6 — CID 171744398
2-[4-[3-[1-(5-chloro-1,3-diazinan-2-yl)piperidin-4-yl]propoxy]-2-fluorocyclohexyl]-1-[2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2,7-diazaspiro[3.4]octan-7-yl]ethanone (PubChem CID 171744398) has the molecular formula C31H55ClFN5O6 and a molecular weight of 648.26 g/mol. Its IUPAC name is 2-[4-[3-[1-(5-chloro-1,3-diazinan-2-yl)piperidin-4-yl]propoxy]-2-fluorocyclohexyl]-1-[2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2,7-diazaspiro[3.4]octan-7-yl]ethanone.
| Compound Name | 2-[4-[3-[1-(5-chloro-1,3-diazinan-2-yl)piperidin-4-yl]propoxy]-2-fluorocyclohexyl]-1-[2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2,7-diazaspiro[3.4]octan-7-yl]ethanone |
|---|---|
| PubChem CID | 171744398 |
| Molecular Formula | C31H55ClFN5O6 |
| Molecular Weight | 648.26 g/mol |
| Exact Mass | 647.38 |
| IUPAC Name | 2-[4-[3-[1-(5-chloro-1,3-diazinan-2-yl)piperidin-4-yl]propoxy]-2-fluorocyclohexyl]-1-[2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2,7-diazaspiro[3.4]octan-7-yl]ethanone |
| SMILES | O=C(CC1CCC(OCCCC2CCN(C3NCC(Cl)CN3)CC2)CC1F)N1CCC2(CN(C[C@H](O)[C@H](O)[C@H](O)CO)C2)C1 |
| InChI | InChI=1S/C31H55ClFN5O6/c32-23-14-34-30(35-15-23)37-8-5-21(6-9-37)2-1-11-44-24-4-3-22(25(33)13-24)12-28(42)38-10-7-31(20-38)18-36(19-31)16-26(40)29(43)27(41)17-39/h21-27,29-30,34-35,39-41,43H,1-20H2/t22?,23?,24?,25?,26-,27+,29-,30?/m0/s1 |
| InChIKey | HWVGXLOWYHQBIR-JJRLTNSJSA-N |
| XLogP | 0.09 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|