C32H45ClFN5O7 — CID 165404339
2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-1-[2-[(2S,3R,5R)-2,3,4,5,6-pentahydroxyhexyl]-2,7-diazaspiro[3.4]octan-7-yl]ethanone (PubChem CID 165404339) has the molecular formula C32H45ClFN5O7 and a molecular weight of 666.19 g/mol. Its IUPAC name is 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-1-[2-[(2S,3R,5R)-2,3,4,5,6-pentahydroxyhexyl]-2,7-diazaspiro[3.4]octan-7-yl]ethanone.
| Compound Name | 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-1-[2-[(2S,3R,5R)-2,3,4,5,6-pentahydroxyhexyl]-2,7-diazaspiro[3.4]octan-7-yl]ethanone |
|---|---|
| PubChem CID | 165404339 |
| Molecular Formula | C32H45ClFN5O7 |
| Molecular Weight | 666.19 g/mol |
| Exact Mass | 665.30 |
| IUPAC Name | 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-1-[2-[(2S,3R,5R)-2,3,4,5,6-pentahydroxyhexyl]-2,7-diazaspiro[3.4]octan-7-yl]ethanone |
| SMILES | O=C(Cc1ccc(OCCCC2CCN(c3ncc(Cl)cn3)CC2)cc1F)N1CCC2(CN(C[C@H](O)[C@@H](O)C(O)[C@H](O)CO)C2)C1 |
| InChI | InChI=1S/C32H45ClFN5O7/c33-23-14-35-31(36-15-23)38-8-5-21(6-9-38)2-1-11-46-24-4-3-22(25(34)13-24)12-28(43)39-10-7-32(20-39)18-37(19-32)16-26(41)29(44)30(45)27(42)17-40/h3-4,13-15,21,26-27,29-30,40-42,44-45H,1-2,5-12,16-20H2/t26-,27+,29+,30?/m0/s1 |
| InChIKey | LWVCXXUOVQNICE-MPWLSHLUSA-N |
| XLogP | 0.86 |
| TPSA | 162.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|