C25H33ClFN5O2 — CID 171744289
2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-1-(1,4-diazepan-1-yl)ethanone (PubChem CID 171744289) has the molecular formula C25H33ClFN5O2 and a molecular weight of 490.02 g/mol. Its IUPAC name is 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-1-(1,4-diazepan-1-yl)ethanone.
| Compound Name | 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-1-(1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 171744289 |
| Molecular Formula | C25H33ClFN5O2 |
| Molecular Weight | 490.02 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-1-(1,4-diazepan-1-yl)ethanone |
| SMILES | O=C(Cc1ccc(OCCCC2CCN(c3ncc(Cl)cn3)CC2)cc1F)N1CCCNCC1 |
| InChI | InChI=1S/C25H33ClFN5O2/c26-21-17-29-25(30-18-21)32-11-6-19(7-12-32)3-1-14-34-22-5-4-20(23(27)16-22)15-24(33)31-10-2-8-28-9-13-31/h4-5,16-19,28H,1-3,6-15H2 |
| InChIKey | AOACSBAGHHGDRC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.02 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|