C22H28FN3O3 — CID 165404534
methyl 2-[2-fluoro-4-[3-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]propoxy]phenyl]acetate (PubChem CID 165404534) has the molecular formula C22H28FN3O3 and a molecular weight of 401.48 g/mol. Its IUPAC name is methyl 2-[2-fluoro-4-[3-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]propoxy]phenyl]acetate.
| Compound Name | methyl 2-[2-fluoro-4-[3-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]propoxy]phenyl]acetate |
|---|---|
| PubChem CID | 165404534 |
| Molecular Formula | C22H28FN3O3 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | methyl 2-[2-fluoro-4-[3-[1-(5-methylpyrimidin-2-yl)piperidin-4-yl]propoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OCCCC2CCN(c3ncc(C)cn3)CC2)cc1F |
| InChI | InChI=1S/C22H28FN3O3/c1-16-14-24-22(25-15-16)26-9-7-17(8-10-26)4-3-11-29-19-6-5-18(20(23)13-19)12-21(27)28-2/h5-6,13-15,17H,3-4,7-12H2,1-2H3 |
| InChIKey | CBQBTPMJTIQBPT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|