C24H32F3N5O2 — CID 44608374
N-(2-aminoethyl)-2,6-dimethyl-4-[3-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]propoxy]benzamide (PubChem CID 44608374) has the molecular formula C24H32F3N5O2 and a molecular weight of 479.55 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,6-dimethyl-4-[3-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]propoxy]benzamide.
| Compound Name | N-(2-aminoethyl)-2,6-dimethyl-4-[3-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]propoxy]benzamide |
|---|---|
| PubChem CID | 44608374 |
| Molecular Formula | C24H32F3N5O2 |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | N-(2-aminoethyl)-2,6-dimethyl-4-[3-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]propoxy]benzamide |
| SMILES | Cc1cc(OCCCC2CCN(c3ncc(C(F)(F)F)cn3)CC2)cc(C)c1C(=O)NCCN |
| InChI | InChI=1S/C24H32F3N5O2/c1-16-12-20(13-17(2)21(16)22(33)29-8-7-28)34-11-3-4-18-5-9-32(10-6-18)23-30-14-19(15-31-23)24(25,26)27/h12-15,18H,3-11,28H2,1-2H3,(H,29,33) |
| InChIKey | GPPAOJFQXVHCAZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|