C22H27F2N3O2 — CID 147226565
1-[4-[3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-difluorophenyl]ethanone (PubChem CID 147226565) has the molecular formula C22H27F2N3O2 and a molecular weight of 403.47 g/mol. Its IUPAC name is 1-[4-[3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-difluorophenyl]ethanone.
| Compound Name | 1-[4-[3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-difluorophenyl]ethanone |
|---|---|
| PubChem CID | 147226565 |
| Molecular Formula | C22H27F2N3O2 |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 1-[4-[3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-difluorophenyl]ethanone |
| SMILES | CCc1cnc(N2CCC(CCCOc3cc(F)c(C(C)=O)c(F)c3)CC2)nc1 |
| InChI | InChI=1S/C22H27F2N3O2/c1-3-16-13-25-22(26-14-16)27-8-6-17(7-9-27)5-4-10-29-18-11-19(23)21(15(2)28)20(24)12-18/h11-14,17H,3-10H2,1-2H3 |
| InChIKey | CICBUUMWGYXGOA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|