C23H33FN4O — CID 77106350
2-fluoro-4-[3-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]propoxy]aniline (PubChem CID 77106350) has the molecular formula C23H33FN4O and a molecular weight of 400.54 g/mol. Its IUPAC name is 2-fluoro-4-[3-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]propoxy]aniline.
| Compound Name | 2-fluoro-4-[3-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]propoxy]aniline |
|---|---|
| PubChem CID | 77106350 |
| Molecular Formula | C23H33FN4O |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2-fluoro-4-[3-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]propoxy]aniline |
| SMILES | CCCCCc1cnc(N2CCC(CCCOc3ccc(N)c(F)c3)CC2)nc1 |
| InChI | InChI=1S/C23H33FN4O/c1-2-3-4-6-19-16-26-23(27-17-19)28-12-10-18(11-13-28)7-5-14-29-20-8-9-22(25)21(24)15-20/h8-9,15-18H,2-7,10-14,25H2,1H3 |
| InChIKey | XNASCGJJVJZMRU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|