C26H35FN4O3 — CID 142719267
4-[3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluoro-N-[(1R,2R)-2-hydroxycyclopentyl]benzamide (PubChem CID 142719267) has the molecular formula C26H35FN4O3 and a molecular weight of 470.59 g/mol. Its IUPAC name is 4-[3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluoro-N-[(1R,2R)-2-hydroxycyclopentyl]benzamide.
| Compound Name | 4-[3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluoro-N-[(1R,2R)-2-hydroxycyclopentyl]benzamide |
|---|---|
| PubChem CID | 142719267 |
| Molecular Formula | C26H35FN4O3 |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 4-[3-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluoro-N-[(1R,2R)-2-hydroxycyclopentyl]benzamide |
| SMILES | CCc1cnc(N2CCC(CCCOc3ccc(C(=O)N[C@@H]4CCC[C@H]4O)c(F)c3)CC2)nc1 |
| InChI | InChI=1S/C26H35FN4O3/c1-2-18-16-28-26(29-17-18)31-12-10-19(11-13-31)5-4-14-34-20-8-9-21(22(27)15-20)25(33)30-23-6-3-7-24(23)32/h8-9,15-17,19,23-24,32H,2-7,10-14H2,1H3,(H,30,33)/t23-,24-/m1/s1 |
| InChIKey | QENFNUPZQBMXIW-DNQXCXABSA-N |
| XLogP | 3.90 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|