C27H33FN4O4 — CID 142753228
2-fluoro-N-[(2S)-2-hydroxypropyl]-4-[3-[1-[5-(5-methylfuran-2-yl)pyrimidin-2-yl]piperidin-4-yl]propoxy]benzamide (PubChem CID 142753228) has the molecular formula C27H33FN4O4 and a molecular weight of 496.58 g/mol. Its IUPAC name is 2-fluoro-N-[(2S)-2-hydroxypropyl]-4-[3-[1-[5-(5-methylfuran-2-yl)pyrimidin-2-yl]piperidin-4-yl]propoxy]benzamide.
| Compound Name | 2-fluoro-N-[(2S)-2-hydroxypropyl]-4-[3-[1-[5-(5-methylfuran-2-yl)pyrimidin-2-yl]piperidin-4-yl]propoxy]benzamide |
|---|---|
| PubChem CID | 142753228 |
| Molecular Formula | C27H33FN4O4 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 2-fluoro-N-[(2S)-2-hydroxypropyl]-4-[3-[1-[5-(5-methylfuran-2-yl)pyrimidin-2-yl]piperidin-4-yl]propoxy]benzamide |
| SMILES | Cc1ccc(-c2cnc(N3CCC(CCCOc4ccc(C(=O)NC[C@H](C)O)c(F)c4)CC3)nc2)o1 |
| InChI | InChI=1S/C27H33FN4O4/c1-18(33)15-29-26(34)23-7-6-22(14-24(23)28)35-13-3-4-20-9-11-32(12-10-20)27-30-16-21(17-31-27)25-8-5-19(2)36-25/h5-8,14,16-18,20,33H,3-4,9-13,15H2,1-2H3,(H,29,34)/t18-/m0/s1 |
| InChIKey | YGUUJTSFGCFNQZ-SFHVURJKSA-N |
| XLogP | 4.37 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|