C28H37FN4O4 — CID 142719257
2-fluoro-N-(2-oxooxolan-3-yl)-4-[3-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]propoxy]benzamide (PubChem CID 142719257) has the molecular formula C28H37FN4O4 and a molecular weight of 512.63 g/mol. Its IUPAC name is 2-fluoro-N-(2-oxooxolan-3-yl)-4-[3-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]propoxy]benzamide.
| Compound Name | 2-fluoro-N-(2-oxooxolan-3-yl)-4-[3-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]propoxy]benzamide |
|---|---|
| PubChem CID | 142719257 |
| Molecular Formula | C28H37FN4O4 |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 2-fluoro-N-(2-oxooxolan-3-yl)-4-[3-[1-(5-pentylpyrimidin-2-yl)piperidin-4-yl]propoxy]benzamide |
| SMILES | CCCCCc1cnc(N2CCC(CCCOc3ccc(C(=O)NC4CCOC4=O)c(F)c3)CC2)nc1 |
| InChI | InChI=1S/C28H37FN4O4/c1-2-3-4-6-21-18-30-28(31-19-21)33-13-10-20(11-14-33)7-5-15-36-22-8-9-23(24(29)17-22)26(34)32-25-12-16-37-27(25)35/h8-9,17-20,25H,2-7,10-16H2,1H3,(H,32,34) |
| InChIKey | UOAJMIZDNLERDR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|