C24H34ClN5O3 — CID 66982967
N-[(2S)-3-amino-2-hydroxypropyl]-4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylbenzamide (PubChem CID 66982967) has the molecular formula C24H34ClN5O3 and a molecular weight of 476.02 g/mol. Its IUPAC name is N-[(2S)-3-amino-2-hydroxypropyl]-4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylbenzamide.
| Compound Name | N-[(2S)-3-amino-2-hydroxypropyl]-4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 66982967 |
| Molecular Formula | C24H34ClN5O3 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | N-[(2S)-3-amino-2-hydroxypropyl]-4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylbenzamide |
| SMILES | Cc1cc(OCCCC2CCN(c3ncc(Cl)cn3)CC2)cc(C)c1C(=O)NC[C@@H](O)CN |
| InChI | InChI=1S/C24H34ClN5O3/c1-16-10-21(11-17(2)22(16)23(32)27-15-20(31)12-26)33-9-3-4-18-5-7-30(8-6-18)24-28-13-19(25)14-29-24/h10-11,13-14,18,20,31H,3-9,12,15,26H2,1-2H3,(H,27,32)/t20-/m0/s1 |
| InChIKey | ZXJWXOKXLQCQAC-FQEVSTJZSA-N |
| XLogP | 2.87 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|