C25H38ClN5O2 — CID 70929224
[[(2S)-4-aminobutan-2-yl]amino]-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylphenyl]methanol (PubChem CID 70929224) has the molecular formula C25H38ClN5O2 and a molecular weight of 476.07 g/mol. Its IUPAC name is [[(2S)-4-aminobutan-2-yl]amino]-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylphenyl]methanol.
| Compound Name | [[(2S)-4-aminobutan-2-yl]amino]-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylphenyl]methanol |
|---|---|
| PubChem CID | 70929224 |
| Molecular Formula | C25H38ClN5O2 |
| Molecular Weight | 476.07 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | [[(2S)-4-aminobutan-2-yl]amino]-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylphenyl]methanol |
| SMILES | Cc1cc(OCCCC2CCN(c3ncc(Cl)cn3)CC2)cc(C)c1C(O)N[C@@H](C)CCN |
| InChI | InChI=1S/C25H38ClN5O2/c1-17-13-22(14-18(2)23(17)24(32)30-19(3)6-9-27)33-12-4-5-20-7-10-31(11-8-20)25-28-15-21(26)16-29-25/h13-16,19-20,24,30,32H,4-12,27H2,1-3H3/t19-,24?/m0/s1 |
| InChIKey | KUJLTAFASCXZBH-XGLRFROISA-N |
| XLogP | 4.14 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.07 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|