C26H36ClN5O2 — CID 44608061
4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethyl-N-[[(2S)-pyrrolidin-2-yl]methyl]benzamide (PubChem CID 44608061) has the molecular formula C26H36ClN5O2 and a molecular weight of 486.06 g/mol. Its IUPAC name is 4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethyl-N-[[(2S)-pyrrolidin-2-yl]methyl]benzamide.
| Compound Name | 4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethyl-N-[[(2S)-pyrrolidin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 44608061 |
| Molecular Formula | C26H36ClN5O2 |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethyl-N-[[(2S)-pyrrolidin-2-yl]methyl]benzamide |
| SMILES | Cc1cc(OCCCC2CCN(c3ncc(Cl)cn3)CC2)cc(C)c1C(=O)NC[C@@H]1CCCN1 |
| InChI | InChI=1S/C26H36ClN5O2/c1-18-13-23(14-19(2)24(18)25(33)29-17-22-6-3-9-28-22)34-12-4-5-20-7-10-32(11-8-20)26-30-15-21(27)16-31-26/h13-16,20,22,28H,3-12,17H2,1-2H3,(H,29,33)/t22-/m0/s1 |
| InChIKey | XWNRGQLMAAYEOF-QFIPXVFZSA-N |
| XLogP | 4.30 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|