C24H32ClN5O2 — CID 44610271
4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-methyl-N-[(3R)-pyrrolidin-3-yl]benzamide (PubChem CID 44610271) has the molecular formula C24H32ClN5O2 and a molecular weight of 458.01 g/mol. Its IUPAC name is 4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-methyl-N-[(3R)-pyrrolidin-3-yl]benzamide.
| Compound Name | 4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-methyl-N-[(3R)-pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 44610271 |
| Molecular Formula | C24H32ClN5O2 |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-methyl-N-[(3R)-pyrrolidin-3-yl]benzamide |
| SMILES | Cc1cc(OCCCC2CCN(c3ncc(Cl)cn3)CC2)ccc1C(=O)N[C@@H]1CCNC1 |
| InChI | InChI=1S/C24H32ClN5O2/c1-17-13-21(4-5-22(17)23(31)29-20-6-9-26-16-20)32-12-2-3-18-7-10-30(11-8-18)24-27-14-19(25)15-28-24/h4-5,13-15,18,20,26H,2-3,6-12,16H2,1H3,(H,29,31)/t20-/m1/s1 |
| InChIKey | FUDBLUONUNSPRB-HXUWFJFHSA-N |
| XLogP | 3.61 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|