C25H34ClN5O2 — CID 66982844
4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethyl-N-pyrrolidin-3-ylbenzamide (PubChem CID 66982844) has the molecular formula C25H34ClN5O2 and a molecular weight of 472.03 g/mol. Its IUPAC name is 4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethyl-N-pyrrolidin-3-ylbenzamide.
| Compound Name | 4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethyl-N-pyrrolidin-3-ylbenzamide |
|---|---|
| PubChem CID | 66982844 |
| Molecular Formula | C25H34ClN5O2 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethyl-N-pyrrolidin-3-ylbenzamide |
| SMILES | Cc1cc(OCCCC2CCN(c3ncc(Cl)cn3)CC2)cc(C)c1C(=O)NC1CCNC1 |
| InChI | InChI=1S/C25H34ClN5O2/c1-17-12-22(13-18(2)23(17)24(32)30-21-5-8-27-16-21)33-11-3-4-19-6-9-31(10-7-19)25-28-14-20(26)15-29-25/h12-15,19,21,27H,3-11,16H2,1-2H3,(H,30,32) |
| InChIKey | SCSVKKXTKRAPRJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|