C21H29ClN4O — CID 70929204
[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylphenyl]methanamine (PubChem CID 70929204) has the molecular formula C21H29ClN4O and a molecular weight of 388.94 g/mol. Its IUPAC name is [4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylphenyl]methanamine.
| Compound Name | [4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylphenyl]methanamine |
|---|---|
| PubChem CID | 70929204 |
| Molecular Formula | C21H29ClN4O |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylphenyl]methanamine |
| SMILES | Cc1cc(OCCCC2CCN(c3ncc(Cl)cn3)CC2)cc(C)c1CN |
| InChI | InChI=1S/C21H29ClN4O/c1-15-10-19(11-16(2)20(15)12-23)27-9-3-4-17-5-7-26(8-6-17)21-24-13-18(22)14-25-21/h10-11,13-14,17H,3-9,12,23H2,1-2H3 |
| InChIKey | SLKWBVMBNNJGQG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|