C25H36ClN5O2 — CID 44608218
N-(4-aminobutyl)-4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylbenzamide (PubChem CID 44608218) has the molecular formula C25H36ClN5O2 and a molecular weight of 474.05 g/mol. Its IUPAC name is N-(4-aminobutyl)-4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylbenzamide.
| Compound Name | N-(4-aminobutyl)-4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 44608218 |
| Molecular Formula | C25H36ClN5O2 |
| Molecular Weight | 474.05 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | N-(4-aminobutyl)-4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-dimethylbenzamide |
| SMILES | Cc1cc(OCCCC2CCN(c3ncc(Cl)cn3)CC2)cc(C)c1C(=O)NCCCCN |
| InChI | InChI=1S/C25H36ClN5O2/c1-18-14-22(15-19(2)23(18)24(32)28-10-4-3-9-27)33-13-5-6-20-7-11-31(12-8-20)25-29-16-21(26)17-30-25/h14-17,20H,3-13,27H2,1-2H3,(H,28,32) |
| InChIKey | JVVVQGSFAVJFGO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.05 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|