C33H50FN5O7 — CID 156723824
2-[2-fluoro-4-[3-[1-(5-propylpyrimidin-2-yl)piperidin-4-yl]propoxy]phenyl]-1-[3-[[[(2S,3R,4R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethanone (PubChem CID 156723824) has the molecular formula C33H50FN5O7 and a molecular weight of 647.79 g/mol. Its IUPAC name is 2-[2-fluoro-4-[3-[1-(5-propylpyrimidin-2-yl)piperidin-4-yl]propoxy]phenyl]-1-[3-[[[(2S,3R,4R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethanone.
| Compound Name | 2-[2-fluoro-4-[3-[1-(5-propylpyrimidin-2-yl)piperidin-4-yl]propoxy]phenyl]-1-[3-[[[(2S,3R,4R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 156723824 |
| Molecular Formula | C33H50FN5O7 |
| Molecular Weight | 647.79 g/mol |
| Exact Mass | 647.37 |
| IUPAC Name | 2-[2-fluoro-4-[3-[1-(5-propylpyrimidin-2-yl)piperidin-4-yl]propoxy]phenyl]-1-[3-[[[(2S,3R,4R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethanone |
| SMILES | CCCc1cnc(N2CCC(CCCOc3ccc(CC(=O)N4CC(CNC[C@H](O)[C@@H](O)[C@H](O)C(O)CO)C4)c(F)c3)CC2)nc1 |
| InChI | InChI=1S/C33H50FN5O7/c1-2-4-23-16-36-33(37-17-23)38-10-8-22(9-11-38)5-3-12-46-26-7-6-25(27(34)14-26)13-30(43)39-19-24(20-39)15-35-18-28(41)31(44)32(45)29(42)21-40/h6-7,14,16-17,22,24,28-29,31-32,35,40-42,44-45H,2-5,8-13,15,18-21H2,1H3/t28-,29?,31+,32+/m0/s1 |
| InChIKey | PAKPEWYTVNUIMF-UMFNFZGXSA-N |
| XLogP | 0.67 |
| TPSA | 171.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.79 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|