C33H49F2N5O7 — CID 174188935
2-[2,6-difluoro-4-[3-[1-(5-propylpyrimidin-2-yl)piperidin-4-yl]propoxy]phenyl]-2-[4-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]piperazin-1-yl]acetaldehyde (PubChem CID 174188935) has the molecular formula C33H49F2N5O7 and a molecular weight of 665.78 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[3-[1-(5-propylpyrimidin-2-yl)piperidin-4-yl]propoxy]phenyl]-2-[4-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]piperazin-1-yl]acetaldehyde.
| Compound Name | 2-[2,6-difluoro-4-[3-[1-(5-propylpyrimidin-2-yl)piperidin-4-yl]propoxy]phenyl]-2-[4-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]piperazin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 174188935 |
| Molecular Formula | C33H49F2N5O7 |
| Molecular Weight | 665.78 g/mol |
| Exact Mass | 665.36 |
| IUPAC Name | 2-[2,6-difluoro-4-[3-[1-(5-propylpyrimidin-2-yl)piperidin-4-yl]propoxy]phenyl]-2-[4-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]piperazin-1-yl]acetaldehyde |
| SMILES | CCCc1cnc(N2CCC(CCCOc3cc(F)c(C(C=O)N4CCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)CC4)c(F)c3)CC2)nc1 |
| InChI | InChI=1S/C33H49F2N5O7/c1-2-4-23-17-36-33(37-18-23)40-8-6-22(7-9-40)5-3-14-47-24-15-25(34)30(26(35)16-24)27(20-41)39-12-10-38(11-13-39)19-28(43)31(45)32(46)29(44)21-42/h15-18,20,22,27-29,31-32,42-46H,2-14,19,21H2,1H3/t27?,28-,29+,31+,32+/m0/s1 |
| InChIKey | QKVVZEBXPLMELW-RITMCNARSA-N |
| XLogP | 1.08 |
| TPSA | 162.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.78 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|