C30H41ClFN5O6 — CID 171744227
2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-1-[6-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]ethanone (PubChem CID 171744227) has the molecular formula C30H41ClFN5O6 and a molecular weight of 622.14 g/mol. Its IUPAC name is 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-1-[6-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]ethanone.
| Compound Name | 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-1-[6-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]ethanone |
|---|---|
| PubChem CID | 171744227 |
| Molecular Formula | C30H41ClFN5O6 |
| Molecular Weight | 622.14 g/mol |
| Exact Mass | 621.27 |
| IUPAC Name | 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-1-[6-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]ethanone |
| SMILES | O=C(Cc1ccc(OCCCC2CCN(c3ncc(Cl)cn3)CC2)cc1F)N1CC2CC(C1)N2C[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C30H41ClFN5O6/c31-21-13-33-30(34-14-21)35-7-5-19(6-8-35)2-1-9-43-24-4-3-20(25(32)12-24)10-28(41)36-15-22-11-23(16-36)37(22)17-26(39)29(42)27(40)18-38/h3-4,12-14,19,22-23,26-27,29,38-40,42H,1-2,5-11,15-18H2/t22?,23?,26-,27+,29-/m0/s1 |
| InChIKey | GVUPGSBVTDQGIM-DYHOCRNXSA-N |
| XLogP | 1.25 |
| TPSA | 142.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.14 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|