C31H45ClFN5O7 — CID 166039724
2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxymethyl]-2-fluorophenyl]-1-[3-[[[(2S,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethanone (PubChem CID 166039724) has the molecular formula C31H45ClFN5O7 and a molecular weight of 654.18 g/mol. Its IUPAC name is 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxymethyl]-2-fluorophenyl]-1-[3-[[[(2S,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethanone.
| Compound Name | 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxymethyl]-2-fluorophenyl]-1-[3-[[[(2S,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 166039724 |
| Molecular Formula | C31H45ClFN5O7 |
| Molecular Weight | 654.18 g/mol |
| Exact Mass | 653.30 |
| IUPAC Name | 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxymethyl]-2-fluorophenyl]-1-[3-[[[(2S,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethanone |
| SMILES | O=C(Cc1ccc(COCCCC2CCN(c3ncc(Cl)cn3)CC2)cc1F)N1CC(CNC[C@H](O)C(O)C(O)[C@H](O)CO)C1 |
| InChI | InChI=1S/C31H45ClFN5O7/c32-24-13-35-31(36-14-24)37-7-5-20(6-8-37)2-1-9-45-19-21-3-4-23(25(33)10-21)11-28(42)38-16-22(17-38)12-34-15-26(40)29(43)30(44)27(41)18-39/h3-4,10,13-14,20,22,26-27,29-30,34,39-41,43-44H,1-2,5-9,11-12,15-19H2/t26-,27+,29?,30?/m0/s1 |
| InChIKey | NMZNPLRSZYSHRA-JFYYBDFESA-N |
| XLogP | 0.51 |
| TPSA | 171.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|