C30H42ClF2N5O6 — CID 165404341
2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-difluorophenyl]-1-[4-[(2S,3S,5S)-2,3,5,6-tetrahydroxyhexyl]piperazin-1-yl]ethanone (PubChem CID 165404341) has the molecular formula C30H42ClF2N5O6 and a molecular weight of 642.14 g/mol. Its IUPAC name is 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-difluorophenyl]-1-[4-[(2S,3S,5S)-2,3,5,6-tetrahydroxyhexyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-difluorophenyl]-1-[4-[(2S,3S,5S)-2,3,5,6-tetrahydroxyhexyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 165404341 |
| Molecular Formula | C30H42ClF2N5O6 |
| Molecular Weight | 642.14 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-difluorophenyl]-1-[4-[(2S,3S,5S)-2,3,5,6-tetrahydroxyhexyl]piperazin-1-yl]ethanone |
| SMILES | O=C(Cc1c(F)cc(OCCCC2CCN(c3ncc(Cl)cn3)CC2)cc1F)N1CCN(C[C@H](O)[C@@H](O)C[C@H](O)CO)CC1 |
| InChI | InChI=1S/C30H42ClF2N5O6/c31-21-16-34-30(35-17-21)38-5-3-20(4-6-38)2-1-11-44-23-13-25(32)24(26(33)14-23)15-29(43)37-9-7-36(8-10-37)18-28(42)27(41)12-22(40)19-39/h13-14,16-17,20,22,27-28,39-42H,1-12,15,18-19H2/t22-,27-,28-/m0/s1 |
| InChIKey | NBIVGQZEWIEBCG-FAQZDJIUSA-N |
| XLogP | 1.64 |
| TPSA | 142.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.14 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|