C31H44F5N3O10 — CID 171744344
[3-(trifluoromethyl)oxetan-3-yl] 4-[3-[3,5-difluoro-4-[2-oxo-2-[4-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]piperazin-1-yl]ethyl]phenoxy]propyl]piperidine-1-carboxylate (PubChem CID 171744344) has the molecular formula C31H44F5N3O10 and a molecular weight of 713.69 g/mol. Its IUPAC name is [3-(trifluoromethyl)oxetan-3-yl] 4-[3-[3,5-difluoro-4-[2-oxo-2-[4-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]piperazin-1-yl]ethyl]phenoxy]propyl]piperidine-1-carboxylate.
| Compound Name | [3-(trifluoromethyl)oxetan-3-yl] 4-[3-[3,5-difluoro-4-[2-oxo-2-[4-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]piperazin-1-yl]ethyl]phenoxy]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171744344 |
| Molecular Formula | C31H44F5N3O10 |
| Molecular Weight | 713.69 g/mol |
| Exact Mass | 713.29 |
| IUPAC Name | [3-(trifluoromethyl)oxetan-3-yl] 4-[3-[3,5-difluoro-4-[2-oxo-2-[4-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]piperazin-1-yl]ethyl]phenoxy]propyl]piperidine-1-carboxylate |
| SMILES | O=C(Cc1c(F)cc(OCCCC2CCN(C(=O)OC3(C(F)(F)F)COC3)CC2)cc1F)N1CCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)CC1 |
| InChI | InChI=1S/C31H44F5N3O10/c32-22-12-20(48-11-1-2-19-3-5-39(6-4-19)29(46)49-30(17-47-18-30)31(34,35)36)13-23(33)21(22)14-26(43)38-9-7-37(8-10-38)15-24(41)27(44)28(45)25(42)16-40/h12-13,19,24-25,27-28,40-42,44-45H,1-11,14-18H2/t24-,25+,27+,28+/m0/s1 |
| InChIKey | KYOASLHBCBKFHS-PAVXMLEDSA-N |
| XLogP | 0.43 |
| TPSA | 172.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.69 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|