C14H26N2O5 — CID 175806396
1-[2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2,7-diazaspiro[3.5]nonan-7-yl]ethanone (PubChem CID 175806396) has the molecular formula C14H26N2O5 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-[2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2,7-diazaspiro[3.5]nonan-7-yl]ethanone.
| Compound Name | 1-[2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2,7-diazaspiro[3.5]nonan-7-yl]ethanone |
|---|---|
| PubChem CID | 175806396 |
| Molecular Formula | C14H26N2O5 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 1-[2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2,7-diazaspiro[3.5]nonan-7-yl]ethanone |
| SMILES | CC(=O)N1CCC2(CC1)CN(C[C@H](O)[C@H](O)[C@H](O)CO)C2 |
| InChI | InChI=1S/C14H26N2O5/c1-10(18)16-4-2-14(3-5-16)8-15(9-14)6-11(19)13(21)12(20)7-17/h11-13,17,19-21H,2-9H2,1H3/t11-,12+,13-/m0/s1 |
| InChIKey | WFABNQLHVFDTNG-XQQFMLRXSA-N |
| XLogP | -1.99 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |