C31H57ClFN5O7 — CID 164773821
2-[4-[3-[1-(5-chloro-1,3-diazinan-2-yl)piperidin-4-yl]propoxymethyl]-2-fluorocyclohexyl]-1-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethanone (PubChem CID 164773821) has the molecular formula C31H57ClFN5O7 and a molecular weight of 666.28 g/mol. Its IUPAC name is 2-[4-[3-[1-(5-chloro-1,3-diazinan-2-yl)piperidin-4-yl]propoxymethyl]-2-fluorocyclohexyl]-1-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethanone.
| Compound Name | 2-[4-[3-[1-(5-chloro-1,3-diazinan-2-yl)piperidin-4-yl]propoxymethyl]-2-fluorocyclohexyl]-1-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 164773821 |
| Molecular Formula | C31H57ClFN5O7 |
| Molecular Weight | 666.28 g/mol |
| Exact Mass | 665.39 |
| IUPAC Name | 2-[4-[3-[1-(5-chloro-1,3-diazinan-2-yl)piperidin-4-yl]propoxymethyl]-2-fluorocyclohexyl]-1-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethanone |
| SMILES | O=C(CC1CCC(COCCCC2CCN(C3NCC(Cl)CN3)CC2)CC1F)N1CC(CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C1 |
| InChI | InChI=1S/C31H57ClFN5O7/c32-24-13-35-31(36-14-24)37-7-5-20(6-8-37)2-1-9-45-19-21-3-4-23(25(33)10-21)11-28(42)38-16-22(17-38)12-34-15-26(40)29(43)30(44)27(41)18-39/h20-27,29-31,34-36,39-41,43-44H,1-19H2/t21?,23?,24?,25?,26-,27+,29+,30+,31?/m0/s1 |
| InChIKey | SUSKVXMXNNJLKU-NAXUNOEQSA-N |
| XLogP | -0.79 |
| TPSA | 170.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.28 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|