C29H49F2N3O8 — CID 164773736
2-[3-[3,5-difluoro-4-[2-oxo-2-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethyl]cyclohexyl]oxypropyl]-6-azaspiro[2.5]octane-6-carbaldehyde (PubChem CID 164773736) has the molecular formula C29H49F2N3O8 and a molecular weight of 605.72 g/mol. Its IUPAC name is 2-[3-[3,5-difluoro-4-[2-oxo-2-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethyl]cyclohexyl]oxypropyl]-6-azaspiro[2.5]octane-6-carbaldehyde.
| Compound Name | 2-[3-[3,5-difluoro-4-[2-oxo-2-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethyl]cyclohexyl]oxypropyl]-6-azaspiro[2.5]octane-6-carbaldehyde |
|---|---|
| PubChem CID | 164773736 |
| Molecular Formula | C29H49F2N3O8 |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.35 |
| IUPAC Name | 2-[3-[3,5-difluoro-4-[2-oxo-2-[3-[[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]ethyl]cyclohexyl]oxypropyl]-6-azaspiro[2.5]octane-6-carbaldehyde |
| SMILES | O=CN1CCC2(CC1)CC2CCCOC1CC(F)C(CC(=O)N2CC(CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C2)C(F)C1 |
| InChI | InChI=1S/C29H49F2N3O8/c30-22-8-20(42-7-1-2-19-11-29(19)3-5-33(17-36)6-4-29)9-23(31)21(22)10-26(39)34-14-18(15-34)12-32-13-24(37)27(40)28(41)25(38)16-35/h17-25,27-28,32,35,37-38,40-41H,1-16H2/t19?,20?,21?,22?,23?,24-,25+,27+,28+/m0/s1 |
| InChIKey | GTPRSOWHVJYTIP-DMOREKGKSA-N |
| XLogP | -0.63 |
| TPSA | 163.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|