C27H46N4O8 — CID 171592373
(2S)-1-[2-[[(7S)-3-[2-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]ethoxy]-1-adamantyl]amino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 171592373) has the molecular formula C27H46N4O8 and a molecular weight of 554.69 g/mol. Its IUPAC name is (2S)-1-[2-[[(7S)-3-[2-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]ethoxy]-1-adamantyl]amino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S)-1-[2-[[(7S)-3-[2-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]ethoxy]-1-adamantyl]amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 171592373 |
| Molecular Formula | C27H46N4O8 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | (2S)-1-[2-[[(7S)-3-[2-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]ethoxy]-1-adamantyl]amino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCN1C(=O)CNC12CC3C[C@@H](C1)CC(OCCOCCNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)(C3)C2 |
| InChI | InChI=1S/C27H46N4O8/c28-13-20-2-1-4-31(20)23(35)15-30-26-9-18-8-19(10-26)12-27(11-18,17-26)39-7-6-38-5-3-29-14-21(33)24(36)25(37)22(34)16-32/h18-22,24-25,29-30,32-34,36-37H,1-12,14-17H2/t18-,19?,20-,21-,22+,24+,25+,26?,27?/m0/s1 |
| InChIKey | IALXYHXCDZJYPC-NTBVYRNUSA-N |
| XLogP | -1.76 |
| TPSA | 187.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|