C17H27N5O3S — CID 73004552
2-cyano-1-[2-[[3-(sulfamoylamino)-1-adamantyl]amino]acetyl]pyrrolidine (PubChem CID 73004552) has the molecular formula C17H27N5O3S and a molecular weight of 381.50 g/mol. Its IUPAC name is 2-cyano-1-[2-[[3-(sulfamoylamino)-1-adamantyl]amino]acetyl]pyrrolidine.
| Compound Name | 2-cyano-1-[2-[[3-(sulfamoylamino)-1-adamantyl]amino]acetyl]pyrrolidine |
|---|---|
| PubChem CID | 73004552 |
| Molecular Formula | C17H27N5O3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-cyano-1-[2-[[3-(sulfamoylamino)-1-adamantyl]amino]acetyl]pyrrolidine |
| SMILES | N#CC1CCCN1C(=O)CNC12CC3CC(C1)CC(NS(N)(=O)=O)(C3)C2 |
| InChI | InChI=1S/C17H27N5O3S/c18-9-14-2-1-3-22(14)15(23)10-20-16-5-12-4-13(6-16)8-17(7-12,11-16)21-26(19,24)25/h12-14,20-21H,1-8,10-11H2,(H2,19,24,25) |
| InChIKey | FTXYXLFHJFKRMC-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |