C19H32N8O2 — CID 11495120
1-(diaminomethylidene)guanidine;(2S)-1-[2-[[(5S,7R)-3-hydroxy-1-adamantyl]amino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 11495120) has the molecular formula C19H32N8O2 and a molecular weight of 404.52 g/mol. Its IUPAC name is 1-(diaminomethylidene)guanidine;(2S)-1-[2-[[(5S,7R)-3-hydroxy-1-adamantyl]amino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | 1-(diaminomethylidene)guanidine;(2S)-1-[2-[[(5S,7R)-3-hydroxy-1-adamantyl]amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 11495120 |
| Molecular Formula | C19H32N8O2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 1-(diaminomethylidene)guanidine;(2S)-1-[2-[[(5S,7R)-3-hydroxy-1-adamantyl]amino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCN1C(=O)CNC12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2.[H]/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C17H25N3O2.C2H7N5/c18-9-14-2-1-3-20(14)15(21)10-19-16-5-12-4-13(6-16)8-17(22,7-12)11-16;3-1(4)7-2(5)6/h12-14,19,22H,1-8,10-11H2;(H7,3,4,5,6,7)/t12-,13+,14-,16?,17?;/m0./s1 |
| InChIKey | HSBYYQRSAMNNDX-KFAPSWDBSA-N |
| XLogP | -0.67 |
| TPSA | 190.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|