C22H29N5O3S — CID 70829549
N-[3-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]-1-adamantyl]pyridine-3-sulfonamide (PubChem CID 70829549) has the molecular formula C22H29N5O3S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[3-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]-1-adamantyl]pyridine-3-sulfonamide.
| Compound Name | N-[3-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]-1-adamantyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 70829549 |
| Molecular Formula | C22H29N5O3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-[3-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]-1-adamantyl]pyridine-3-sulfonamide |
| SMILES | N#CC1CCCN1C(=O)CNC12CC3CC(C1)CC(NS(=O)(=O)c1cccnc1)(C3)C2 |
| InChI | InChI=1S/C22H29N5O3S/c23-12-18-3-2-6-27(18)20(28)14-25-21-8-16-7-17(9-21)11-22(10-16,15-21)26-31(29,30)19-4-1-5-24-13-19/h1,4-5,13,16-18,25-26H,2-3,6-11,14-15H2 |
| InChIKey | ZEEABVOBIVPDPM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |