C28H36N4O8 — CID 175758201
2-[2-[[(7S)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl]oxy]ethoxy]ethyl (4-nitrophenyl) carbonate (PubChem CID 175758201) has the molecular formula C28H36N4O8 and a molecular weight of 556.62 g/mol. Its IUPAC name is 2-[2-[[(7S)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl]oxy]ethoxy]ethyl (4-nitrophenyl) carbonate.
| Compound Name | 2-[2-[[(7S)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl]oxy]ethoxy]ethyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 175758201 |
| Molecular Formula | C28H36N4O8 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 2-[2-[[(7S)-3-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]-1-adamantyl]oxy]ethoxy]ethyl (4-nitrophenyl) carbonate |
| SMILES | N#C[C@@H]1CCCN1C(=O)CNC12CC3C[C@@H](C1)CC(OCCOCCOC(=O)Oc1ccc([N+](=O)[O-])cc1)(C3)C2 |
| InChI | InChI=1S/C28H36N4O8/c29-17-23-2-1-7-31(23)25(33)18-30-27-13-20-12-21(14-27)16-28(15-20,19-27)39-11-9-37-8-10-38-26(34)40-24-5-3-22(4-6-24)32(35)36/h3-6,20-21,23,30H,1-2,7-16,18-19H2/t20-,21?,23-,27?,28?/m0/s1 |
| InChIKey | ILPMRGBPARHDNQ-NGSHYSTHSA-N |
| XLogP | 3.34 |
| TPSA | 153.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|