C27H32N4O9 — CID 174237843
[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]-[(7S)-3-[2-(4-nitrophenoxy)carbonyloxyethoxy]-1-adamantyl]carbamic acid (PubChem CID 174237843) has the molecular formula C27H32N4O9 and a molecular weight of 556.57 g/mol. Its IUPAC name is [2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]-[(7S)-3-[2-(4-nitrophenoxy)carbonyloxyethoxy]-1-adamantyl]carbamic acid.
| Compound Name | [2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]-[(7S)-3-[2-(4-nitrophenoxy)carbonyloxyethoxy]-1-adamantyl]carbamic acid |
|---|---|
| PubChem CID | 174237843 |
| Molecular Formula | C27H32N4O9 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | [2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]-[(7S)-3-[2-(4-nitrophenoxy)carbonyloxyethoxy]-1-adamantyl]carbamic acid |
| SMILES | N#CC1CCCN1C(=O)CN(C(=O)O)C12CC3C[C@H](CC(OCCOC(=O)Oc4ccc([N+](=O)[O-])cc4)(C3)C1)C2 |
| InChI | InChI=1S/C27H32N4O9/c28-15-21-2-1-7-29(21)23(32)16-30(24(33)34)26-11-18-10-19(12-26)14-27(13-18,17-26)39-9-8-38-25(35)40-22-5-3-20(4-6-22)31(36)37/h3-6,18-19,21H,1-2,7-14,16-17H2,(H,33,34)/t18-,19?,21?,26?,27?/m0/s1 |
| InChIKey | MNTZFFCLISYOHE-ZHPDEFFISA-N |
| XLogP | 3.71 |
| TPSA | 172.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|