C22H26N4O3 — CID 24853442
(2S)-1-[2-[[1-(4-nitrophenyl)-3-tricyclo[3.3.1.03,7]nonanyl]amino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 24853442) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is (2S)-1-[2-[[1-(4-nitrophenyl)-3-tricyclo[3.3.1.03,7]nonanyl]amino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S)-1-[2-[[1-(4-nitrophenyl)-3-tricyclo[3.3.1.03,7]nonanyl]amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 24853442 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (2S)-1-[2-[[1-(4-nitrophenyl)-3-tricyclo[3.3.1.03,7]nonanyl]amino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCN1C(=O)CNC12CC3CC1CC(c1ccc([N+](=O)[O-])cc1)(C3)C2 |
| InChI | InChI=1S/C22H26N4O3/c23-12-19-2-1-7-25(19)20(27)13-24-22-10-15-8-17(22)11-21(9-15,14-22)16-3-5-18(6-4-16)26(28)29/h3-6,15,17,19,24H,1-2,7-11,13-14H2/t15?,17?,19-,21?,22?/m0/s1 |
| InChIKey | YCIVZIZGYIKFTP-RZCQSOCGSA-N |
| XLogP | 2.90 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|