C32H40N4O9 — CID 169223919
2-[[3-[1-(tert-butylcarbamoyloxy)-2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-1-adamantyl]oxy]ethyl (4-nitrophenyl) carbonate (PubChem CID 169223919) has the molecular formula C32H40N4O9 and a molecular weight of 624.69 g/mol. Its IUPAC name is 2-[[3-[1-(tert-butylcarbamoyloxy)-2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-1-adamantyl]oxy]ethyl (4-nitrophenyl) carbonate.
| Compound Name | 2-[[3-[1-(tert-butylcarbamoyloxy)-2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-1-adamantyl]oxy]ethyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 169223919 |
| Molecular Formula | C32H40N4O9 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 624.28 |
| IUPAC Name | 2-[[3-[1-(tert-butylcarbamoyloxy)-2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-1-adamantyl]oxy]ethyl (4-nitrophenyl) carbonate |
| SMILES | CC(C)(C)NC(=O)OC(C(=O)N1[C@H](C#N)C[C@@H]2C[C@@H]21)C12CC3CC(CC(OCCOC(=O)Oc4ccc([N+](=O)[O-])cc4)(C3)C1)C2 |
| InChI | InChI=1S/C32H40N4O9/c1-30(2,3)34-28(38)45-26(27(37)35-23(17-33)11-21-12-25(21)35)31-13-19-10-20(14-31)16-32(15-19,18-31)43-9-8-42-29(39)44-24-6-4-22(5-7-24)36(40)41/h4-7,19-21,23,25-26H,8-16,18H2,1-3H3,(H,34,38)/t19?,20?,21-,23+,25+,26?,31?,32?/m1/s1 |
| InChIKey | DRSYQYRAEIJASB-UPHQKCMESA-N |
| XLogP | 4.87 |
| TPSA | 170.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|