C24H32N2O7S — CID 175497405
2-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-adamantyl]sulfanyl]ethyl (4-nitrophenyl) carbonate (PubChem CID 175497405) has the molecular formula C24H32N2O7S and a molecular weight of 492.59 g/mol. Its IUPAC name is 2-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-adamantyl]sulfanyl]ethyl (4-nitrophenyl) carbonate.
| Compound Name | 2-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-adamantyl]sulfanyl]ethyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 175497405 |
| Molecular Formula | C24H32N2O7S |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 2-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-adamantyl]sulfanyl]ethyl (4-nitrophenyl) carbonate |
| SMILES | CC(C)(C)OC(=O)NC12CC3CC(C1)CC(SCCOC(=O)Oc1ccc([N+](=O)[O-])cc1)(C3)C2 |
| InChI | InChI=1S/C24H32N2O7S/c1-22(2,3)33-20(27)25-23-11-16-10-17(12-23)14-24(13-16,15-23)34-9-8-31-21(28)32-19-6-4-18(5-7-19)26(29)30/h4-7,16-17H,8-15H2,1-3H3,(H,25,27) |
| InChIKey | HIWFZUOVXKNKRB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|