C19H31NO7S — CID 122443000
S-[[4-[2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl] 2-methylpropanethioate (PubChem CID 122443000) has the molecular formula C19H31NO7S and a molecular weight of 417.52 g/mol. Its IUPAC name is S-[[4-[2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl] 2-methylpropanethioate.
| Compound Name | S-[[4-[2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 122443000 |
| Molecular Formula | C19H31NO7S |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | S-[[4-[2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]methyl] 2-methylpropanethioate |
| SMILES | CC(C)C(=O)SCc1ccc(OCCNC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C19H31NO7S/c1-12(2)19(26)28-11-13-3-5-14(6-4-13)27-8-7-20-9-15(22)17(24)18(25)16(23)10-21/h3-6,12,15-18,20-25H,7-11H2,1-2H3/t15-,16-,17-,18-/m1/s1 |
| InChIKey | VLAPCTODTLQQOW-BRSBDYLESA-N |
| XLogP | -0.49 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|