C17H26N2O9 — CID 172529782
(2S)-2-amino-3-[4-[2-oxo-2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 172529782) has the molecular formula C17H26N2O9 and a molecular weight of 402.40 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[2-oxo-2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[2-oxo-2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 172529782 |
| Molecular Formula | C17H26N2O9 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (2S)-2-amino-3-[4-[2-oxo-2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(OCC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc1)C(=O)O |
| InChI | InChI=1S/C17H26N2O9/c18-11(17(26)27)5-9-1-3-10(4-2-9)28-8-14(23)19-6-12(21)15(24)16(25)13(22)7-20/h1-4,11-13,15-16,20-22,24-25H,5-8,18H2,(H,19,23)(H,26,27)/t11-,12-,13+,15+,16+/m0/s1 |
| InChIKey | UIQDGAGJTOZOIF-QZPUYBJASA-N |
| XLogP | -3.43 |
| TPSA | 202.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |