C29H46FN3O6 — CID 156723843
2-[4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-fluorophenyl]-1-[3-[[[(2S,3S,4R)-2,3,4,6-tetrahydroxy-5-methylhexyl]amino]methyl]azetidin-1-yl]ethanone (PubChem CID 156723843) has the molecular formula C29H46FN3O6 and a molecular weight of 551.70 g/mol. Its IUPAC name is 2-[4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-fluorophenyl]-1-[3-[[[(2S,3S,4R)-2,3,4,6-tetrahydroxy-5-methylhexyl]amino]methyl]azetidin-1-yl]ethanone.
| Compound Name | 2-[4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-fluorophenyl]-1-[3-[[[(2S,3S,4R)-2,3,4,6-tetrahydroxy-5-methylhexyl]amino]methyl]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 156723843 |
| Molecular Formula | C29H46FN3O6 |
| Molecular Weight | 551.70 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | 2-[4-[2-(7-azaspiro[3.5]nonan-2-yl)ethoxy]-2-fluorophenyl]-1-[3-[[[(2S,3S,4R)-2,3,4,6-tetrahydroxy-5-methylhexyl]amino]methyl]azetidin-1-yl]ethanone |
| SMILES | CC(CO)[C@@H](O)[C@H](O)[C@@H](O)CNCC1CN(C(=O)Cc2ccc(OCCC3CC4(CCNCC4)C3)cc2F)C1 |
| InChI | InChI=1S/C29H46FN3O6/c1-19(18-34)27(37)28(38)25(35)15-32-14-21-16-33(17-21)26(36)10-22-2-3-23(11-24(22)30)39-9-4-20-12-29(13-20)5-7-31-8-6-29/h2-3,11,19-21,25,27-28,31-32,34-35,37-38H,4-10,12-18H2,1H3/t19?,25-,27+,28+/m0/s1 |
| InChIKey | XSBRDGKUDVXIGH-CBVRBYBGSA-N |
| XLogP | 0.68 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.70 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |