C10H14O7 — CID 175779096
(2R,3R,4R,5R)-1-(furan-2-yl)-2,3,4,5,6-pentahydroxyhexan-1-one (PubChem CID 175779096) has the molecular formula C10H14O7 and a molecular weight of 246.22 g/mol. Its IUPAC name is (2R,3R,4R,5R)-1-(furan-2-yl)-2,3,4,5,6-pentahydroxyhexan-1-one.
| Compound Name | (2R,3R,4R,5R)-1-(furan-2-yl)-2,3,4,5,6-pentahydroxyhexan-1-one |
|---|---|
| PubChem CID | 175779096 |
| Molecular Formula | C10H14O7 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (2R,3R,4R,5R)-1-(furan-2-yl)-2,3,4,5,6-pentahydroxyhexan-1-one |
| SMILES | O=C(c1ccco1)[C@H](O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H14O7/c11-4-5(12)7(13)9(15)10(16)8(14)6-2-1-3-17-6/h1-3,5,7,9-13,15-16H,4H2/t5-,7-,9-,10+/m1/s1 |
| InChIKey | COAGZPMUBDMREB-PXMQNUKVSA-N |
| XLogP | -2.10 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |