C13H21NO7 — CID 59083594
(2S)-2-[[(1R,2S,3R,4R)-1-(furan-2-yl)-2,3,4,5-tetrahydroxypentyl]amino]butanoic acid (PubChem CID 59083594) has the molecular formula C13H21NO7 and a molecular weight of 303.31 g/mol. Its IUPAC name is (2S)-2-[[(1R,2S,3R,4R)-1-(furan-2-yl)-2,3,4,5-tetrahydroxypentyl]amino]butanoic acid.
| Compound Name | (2S)-2-[[(1R,2S,3R,4R)-1-(furan-2-yl)-2,3,4,5-tetrahydroxypentyl]amino]butanoic acid |
|---|---|
| PubChem CID | 59083594 |
| Molecular Formula | C13H21NO7 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (2S)-2-[[(1R,2S,3R,4R)-1-(furan-2-yl)-2,3,4,5-tetrahydroxypentyl]amino]butanoic acid |
| SMILES | CC[C@H](N[C@@H](c1ccco1)[C@H](O)[C@@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C13H21NO7/c1-2-7(13(19)20)14-10(9-4-3-5-21-9)12(18)11(17)8(16)6-15/h3-5,7-8,10-12,14-18H,2,6H2,1H3,(H,19,20)/t7-,8+,10-,11-,12-/m0/s1 |
| InChIKey | VOSJINWZINENGT-JEPNRXRBSA-N |
| XLogP | -1.15 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |