C7H9NO4 — CID 504251
(2S)-2-(furan-2-ylamino)-3-hydroxypropanoic acid (PubChem CID 504251) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is (2S)-2-(furan-2-ylamino)-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-(furan-2-ylamino)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 504251 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | (2S)-2-(furan-2-ylamino)-3-hydroxypropanoic acid |
| SMILES | O=C(O)[C@H](CO)Nc1ccco1 |
| InChI | InChI=1S/C7H9NO4/c9-4-5(7(10)11)8-6-2-1-3-12-6/h1-3,5,8-9H,4H2,(H,10,11)/t5-/m0/s1 |
| InChIKey | JJRNTGNTJHYEHG-YFKPBYRVSA-N |
| XLogP | 0.14 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |