C14H13NO5 — CID 61152901
(2S)-3-hydroxy-2-[(3-phenylfuran-2-carbonyl)amino]propanoic acid (PubChem CID 61152901) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[(3-phenylfuran-2-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-[(3-phenylfuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 61152901 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (2S)-3-hydroxy-2-[(3-phenylfuran-2-carbonyl)amino]propanoic acid |
| SMILES | O=C(N[C@@H](CO)C(=O)O)c1occc1-c1ccccc1 |
| InChI | InChI=1S/C14H13NO5/c16-8-11(14(18)19)15-13(17)12-10(6-7-20-12)9-4-2-1-3-5-9/h1-7,11,16H,8H2,(H,15,17)(H,18,19)/t11-/m0/s1 |
| InChIKey | CRRHXIYPWOBVHB-NSHDSACASA-N |
| XLogP | 1.12 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |