C12H18O8 — CID 23619316
furo[3,2-b]furan;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol (PubChem CID 23619316) has the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. Its IUPAC name is furo[3,2-b]furan;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol.
| Compound Name | furo[3,2-b]furan;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 23619316 |
| Molecular Formula | C12H18O8 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | furo[3,2-b]furan;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO.c1cc2occc2o1 |
| InChI | InChI=1S/C6H14O6.C6H4O2/c7-1-3(9)5(11)6(12)4(10)2-8;1-3-7-6-2-4-8-5(1)6/h3-12H,1-2H2;1-4H/t3-,4+,5-,6-;/m1./s1 |
| InChIKey | WSDHDLWRDQREID-VFQQELCFSA-N |
| XLogP | -1.56 |
| TPSA | 147.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |