C16H27NO3 — CID 95285904
(2R)-1-[2-methoxyethyl(2-methylpropyl)amino]-3-phenoxypropan-2-ol (PubChem CID 95285904) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is (2R)-1-[2-methoxyethyl(2-methylpropyl)amino]-3-phenoxypropan-2-ol.
| Compound Name | (2R)-1-[2-methoxyethyl(2-methylpropyl)amino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 95285904 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | (2R)-1-[2-methoxyethyl(2-methylpropyl)amino]-3-phenoxypropan-2-ol |
| SMILES | COCCN(CC(C)C)C[C@@H](O)COc1ccccc1 |
| InChI | InChI=1S/C16H27NO3/c1-14(2)11-17(9-10-19-3)12-15(18)13-20-16-7-5-4-6-8-16/h4-8,14-15,18H,9-13H2,1-3H3/t15-/m1/s1 |
| InChIKey | VWIFMNRHKNOENN-OAHLLOKOSA-N |
| XLogP | 2.03 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |